C14H19NO2 — CID 57311710
1-(1-cyclohexylbut-3-ynyl)pyrrole-2,5-diol (PubChem CID 57311710) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(1-cyclohexylbut-3-ynyl)pyrrole-2,5-diol.
| Compound Name | 1-(1-cyclohexylbut-3-ynyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 57311710 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(1-cyclohexylbut-3-ynyl)pyrrole-2,5-diol |
| SMILES | C#CCC(C1CCCCC1)n1c(O)ccc1O |
| InChI | InChI=1S/C14H19NO2/c1-2-6-12(11-7-4-3-5-8-11)15-13(16)9-10-14(15)17/h1,9-12,16-17H,3-8H2 |
| InChIKey | PDJUQUIKGLDIHU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|