C18H34O3 — CID 57074690
12,12-di(propan-2-yloxy)dodeca-6,9-dien-2-ol (PubChem CID 57074690) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is 12,12-di(propan-2-yloxy)dodeca-6,9-dien-2-ol.
| Compound Name | 12,12-di(propan-2-yloxy)dodeca-6,9-dien-2-ol |
|---|---|
| PubChem CID | 57074690 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 12,12-di(propan-2-yloxy)dodeca-6,9-dien-2-ol |
| SMILES | CC(O)CCCC=CCC=CCC(OC(C)C)OC(C)C |
| InChI | InChI=1S/C18H34O3/c1-15(2)20-18(21-16(3)4)14-12-10-8-6-7-9-11-13-17(5)19/h6-7,10,12,15-19H,8-9,11,13-14H2,1-5H3 |
| InChIKey | FFWWMKKHLYWINF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|