C19H38N4 — CID 57074798
1-[bis(4-aminocyclohexyl)methyl]cyclohexane-1,4-diamine (PubChem CID 57074798) has the molecular formula C19H38N4 and a molecular weight of 322.54 g/mol. Its IUPAC name is 1-[bis(4-aminocyclohexyl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 1-[bis(4-aminocyclohexyl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 57074798 |
| Molecular Formula | C19H38N4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.31 |
| IUPAC Name | 1-[bis(4-aminocyclohexyl)methyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(C(C2CCC(N)CC2)C2(N)CCC(N)CC2)CC1 |
| InChI | InChI=1S/C19H38N4/c20-15-5-1-13(2-6-15)18(14-3-7-16(21)8-4-14)19(23)11-9-17(22)10-12-19/h13-18H,1-12,20-23H2 |
| InChIKey | NLJVQCKGUZJTPM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |