About 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine
1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine (PubChem CID 105431584) has the molecular formula C8H13F2N
and a molecular weight of 161.19 g/mol. Its IUPAC name is 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine.
Analyze 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine?
The IUPAC name of 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine (CID 105431584) is 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine.
What is the SMILES notation for 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine?
The canonical SMILES for 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine is NC1(C(C(F)F)C2CC2)CC1.
What is the InChIKey of 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine?
The InChIKey is HALVNPHRMXYAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2N/c9-7(10)6(5-1-2-5)8(11)3-4-8/h5-7H,1-4,11H2.
What are the key properties of 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine?
1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine has a molecular weight of 161.19 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopropyl-2,2-difluoroethyl)cyclopropan-1-amine is sourced from PubChem (CID 105431584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).