C19H26N2O3 — CID 57075119
3-tert-butyl-5-(phenylmethoxyamino)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 57075119) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-tert-butyl-5-(phenylmethoxyamino)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | 3-tert-butyl-5-(phenylmethoxyamino)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 57075119 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 3-tert-butyl-5-(phenylmethoxyamino)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | CC(C)(C)C1C2C=C(NOCc3ccccc3)CC2CN1C(=O)O |
| InChI | InChI=1S/C19H26N2O3/c1-19(2,3)17-16-10-15(9-14(16)11-21(17)18(22)23)20-24-12-13-7-5-4-6-8-13/h4-8,10,14,16-17,20H,9,11-12H2,1-3H3,(H,22,23) |
| InChIKey | VCXLGBDDRMRELJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|