C16H19IN2O2 — CID 57012470
2-iodo-1-[5-(phenylmethoxyamino)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]ethanone (PubChem CID 57012470) has the molecular formula C16H19IN2O2 and a molecular weight of 398.24 g/mol. Its IUPAC name is 2-iodo-1-[5-(phenylmethoxyamino)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]ethanone.
| Compound Name | 2-iodo-1-[5-(phenylmethoxyamino)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 57012470 |
| Molecular Formula | C16H19IN2O2 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-iodo-1-[5-(phenylmethoxyamino)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]ethanone |
| SMILES | O=C(CI)N1CC2C=C(NOCc3ccccc3)CC2C1 |
| InChI | InChI=1S/C16H19IN2O2/c17-8-16(20)19-9-13-6-15(7-14(13)10-19)18-21-11-12-4-2-1-3-5-12/h1-6,13-14,18H,7-11H2 |
| InChIKey | YZZDQQOXOHBFDS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|