C23H20N2O5S — CID 57075281
(6S,7S,8R,9R)-7,10-dioxo-5-phenyl-9-[(2-phenylacetyl)amino]-7λ4-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylic acid (PubChem CID 57075281) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is (6S,7S,8R,9R)-7,10-dioxo-5-phenyl-9-[(2-phenylacetyl)amino]-7λ4-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylic acid.
| Compound Name | (6S,7S,8R,9R)-7,10-dioxo-5-phenyl-9-[(2-phenylacetyl)amino]-7λ4-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57075281 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (6S,7S,8R,9R)-7,10-dioxo-5-phenyl-9-[(2-phenylacetyl)amino]-7λ4-thia-1-azatricyclo[6.2.0.03,6]dec-2-ene-2-carboxylic acid |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2C(C(=O)O)=C3CC(c4ccccc4)[C@@H]3[S@](=O)[C@H]12 |
| InChI | InChI=1S/C23H20N2O5S/c26-17(11-13-7-3-1-4-8-13)24-18-21(27)25-19(23(28)29)16-12-15(14-9-5-2-6-10-14)20(16)31(30)22(18)25/h1-10,15,18,20,22H,11-12H2,(H,24,26)(H,28,29)/t15?,18-,20+,22-,31+/m1/s1 |
| InChIKey | SUMHJLJLEDJASE-FHGIQWLISA-N |
| XLogP | 1.54 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |