C27H20N4O5S — CID 57077487
2-(2,1,3-benzothiadiazol-5-yl)-4-(2,5-dimethoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid (PubChem CID 57077487) has the molecular formula C27H20N4O5S and a molecular weight of 512.55 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-5-yl)-4-(2,5-dimethoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid.
| Compound Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(2,5-dimethoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid |
|---|---|
| PubChem CID | 57077487 |
| Molecular Formula | C27H20N4O5S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-5-yl)-4-(2,5-dimethoxyphenyl)-4-oxo-3-(quinoxalin-6-ylmethyl)but-2-enoic acid |
| SMILES | COc1ccc(OC)c(C(=O)C(Cc2ccc3nccnc3c2)=C(C(=O)O)c2ccc3nsnc3c2)c1 |
| InChI | InChI=1S/C27H20N4O5S/c1-35-17-5-8-24(36-2)18(14-17)26(32)19(11-15-3-6-20-22(12-15)29-10-9-28-20)25(27(33)34)16-4-7-21-23(13-16)31-37-30-21/h3-10,12-14H,11H2,1-2H3,(H,33,34) |
| InChIKey | PGSCGQYKUSZRNX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|