C16H18O6 — CID 57078360
bis(2-methylpropanoyl) benzene-1,3-dicarboxylate (PubChem CID 57078360) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is bis(2-methylpropanoyl) benzene-1,3-dicarboxylate.
| Compound Name | bis(2-methylpropanoyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 57078360 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | bis(2-methylpropanoyl) benzene-1,3-dicarboxylate |
| SMILES | CC(C)C(=O)OC(=O)c1cccc(C(=O)OC(=O)C(C)C)c1 |
| InChI | InChI=1S/C16H18O6/c1-9(2)13(17)21-15(19)11-6-5-7-12(8-11)16(20)22-14(18)10(3)4/h5-10H,1-4H3 |
| InChIKey | CNWSKRGMUPQRJX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|