C14H14O10 — CID 141266560
bis(2,3-dihydroxypropanoyl) benzene-1,3-dicarboxylate (PubChem CID 141266560) has the molecular formula C14H14O10 and a molecular weight of 342.26 g/mol. Its IUPAC name is bis(2,3-dihydroxypropanoyl) benzene-1,3-dicarboxylate.
| Compound Name | bis(2,3-dihydroxypropanoyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 141266560 |
| Molecular Formula | C14H14O10 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | bis(2,3-dihydroxypropanoyl) benzene-1,3-dicarboxylate |
| SMILES | O=C(OC(=O)C(O)CO)c1cccc(C(=O)OC(=O)C(O)CO)c1 |
| InChI | InChI=1S/C14H14O10/c15-5-9(17)13(21)23-11(19)7-2-1-3-8(4-7)12(20)24-14(22)10(18)6-16/h1-4,9-10,15-18H,5-6H2 |
| InChIKey | PMQQRQNAFQWUHB-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|