C14H15N3O3 — CID 57078576
6-cyclobutyloxyindole-1,3-dicarboxamide (PubChem CID 57078576) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 6-cyclobutyloxyindole-1,3-dicarboxamide.
| Compound Name | 6-cyclobutyloxyindole-1,3-dicarboxamide |
|---|---|
| PubChem CID | 57078576 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 6-cyclobutyloxyindole-1,3-dicarboxamide |
| SMILES | NC(=O)c1cn(C(N)=O)c2cc(OC3CCC3)ccc12 |
| InChI | InChI=1S/C14H15N3O3/c15-13(18)11-7-17(14(16)19)12-6-9(4-5-10(11)12)20-8-2-1-3-8/h4-8H,1-3H2,(H2,15,18)(H2,16,19) |
| InChIKey | LKLQQSOHEYDHHD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |