C18H20N2O — CID 57079545
1-(3-benzyl-2,5-dihydro-1,2-oxazol-5-yl)-2-phenylethanamine (PubChem CID 57079545) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(3-benzyl-2,5-dihydro-1,2-oxazol-5-yl)-2-phenylethanamine.
| Compound Name | 1-(3-benzyl-2,5-dihydro-1,2-oxazol-5-yl)-2-phenylethanamine |
|---|---|
| PubChem CID | 57079545 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(3-benzyl-2,5-dihydro-1,2-oxazol-5-yl)-2-phenylethanamine |
| SMILES | NC(Cc1ccccc1)C1C=C(Cc2ccccc2)NO1 |
| InChI | InChI=1S/C18H20N2O/c19-17(12-15-9-5-2-6-10-15)18-13-16(20-21-18)11-14-7-3-1-4-8-14/h1-10,13,17-18,20H,11-12,19H2 |
| InChIKey | NVOANZKOOQYBKZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |