C18H27FN2O — CID 57080099
1-N-fluoro-4-methyl-1-N-(oxolan-2-ylmethyl)-3-N-phenylcyclohexane-1,3-diamine (PubChem CID 57080099) has the molecular formula C18H27FN2O and a molecular weight of 306.42 g/mol. Its IUPAC name is 1-N-fluoro-4-methyl-1-N-(oxolan-2-ylmethyl)-3-N-phenylcyclohexane-1,3-diamine.
| Compound Name | 1-N-fluoro-4-methyl-1-N-(oxolan-2-ylmethyl)-3-N-phenylcyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 57080099 |
| Molecular Formula | C18H27FN2O |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-N-fluoro-4-methyl-1-N-(oxolan-2-ylmethyl)-3-N-phenylcyclohexane-1,3-diamine |
| SMILES | CC1CCC(N(F)CC2CCCO2)CC1Nc1ccccc1 |
| InChI | InChI=1S/C18H27FN2O/c1-14-9-10-16(21(19)13-17-8-5-11-22-17)12-18(14)20-15-6-3-2-4-7-15/h2-4,6-7,14,16-18,20H,5,8-13H2,1H3 |
| InChIKey | TUJHBTRHNLOHSF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|