C24H23FN2O2 — CID 57081498
2-[4-fluoro-3-[formyl(methyl)amino]phenyl]-N-[3-(2-phenylethyl)phenyl]acetamide (PubChem CID 57081498) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-[4-fluoro-3-[formyl(methyl)amino]phenyl]-N-[3-(2-phenylethyl)phenyl]acetamide.
| Compound Name | 2-[4-fluoro-3-[formyl(methyl)amino]phenyl]-N-[3-(2-phenylethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 57081498 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[4-fluoro-3-[formyl(methyl)amino]phenyl]-N-[3-(2-phenylethyl)phenyl]acetamide |
| SMILES | CN(C=O)c1cc(CC(=O)Nc2cccc(CCc3ccccc3)c2)ccc1F |
| InChI | InChI=1S/C24H23FN2O2/c1-27(17-28)23-15-20(12-13-22(23)25)16-24(29)26-21-9-5-8-19(14-21)11-10-18-6-3-2-4-7-18/h2-9,12-15,17H,10-11,16H2,1H3,(H,26,29) |
| InChIKey | MIKJHENBSLYPDE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|