C21H28BrClO3 — CID 57081693
(8S,9S,10R,13S,14S,17S)-17-acetyl-6-bromo-6-chloro-1-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57081693) has the molecular formula C21H28BrClO3 and a molecular weight of 443.81 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-acetyl-6-bromo-6-chloro-1-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-acetyl-6-bromo-6-chloro-1-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57081693 |
| Molecular Formula | C21H28BrClO3 |
| Molecular Weight | 443.81 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-acetyl-6-bromo-6-chloro-1-hydroxy-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC(Cl)(Br)C4=CC(=O)CC(O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H28BrClO3/c1-11(24)14-4-5-15-13-10-21(22,23)17-8-12(25)9-18(26)20(17,3)16(13)6-7-19(14,15)2/h8,13-16,18,26H,4-7,9-10H2,1-3H3/t13-,14+,15-,16-,18?,19+,20+,21?/m0/s1 |
| InChIKey | DEQKAPUTEGYFKV-ZPPLXEDXSA-N |
| XLogP | 4.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.81 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|