About methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate
methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate (PubChem CID 57081993) has the molecular formula C11H8F3NO2S
and a molecular weight of 275.25 g/mol. Its IUPAC name is methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate.
Analyze methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate?
The IUPAC name of methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate (CID 57081993) is methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate.
What is the SMILES notation for methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate?
The canonical SMILES for methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate is COC(=O)C1C=Nc2ccc(C(F)(F)F)cc2S1.
What is the InChIKey of methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate?
The InChIKey is OZJKJXKZNYJHEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F3NO2S/c1-17-10(16)9-5-15-7-3-2-6(11(12,13)14)4-8(7)18-9/h2-5,9H,1H3.
What are the key properties of methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate?
methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate has a molecular weight of 275.25 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-(trifluoromethyl)-2H-1,4-benzothiazine-2-carboxylate is sourced from PubChem (CID 57081993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).