C22H30N2O — CID 57082244
8-amino-3-phenyl-3-(2-phenylethyl)octanamide (PubChem CID 57082244) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 8-amino-3-phenyl-3-(2-phenylethyl)octanamide.
| Compound Name | 8-amino-3-phenyl-3-(2-phenylethyl)octanamide |
|---|---|
| PubChem CID | 57082244 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 8-amino-3-phenyl-3-(2-phenylethyl)octanamide |
| SMILES | NCCCCCC(CCc1ccccc1)(CC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O/c23-17-9-3-8-15-22(18-21(24)25,20-12-6-2-7-13-20)16-14-19-10-4-1-5-11-19/h1-2,4-7,10-13H,3,8-9,14-18,23H2,(H2,24,25) |
| InChIKey | MFFZGMIFGLTCGN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|