C18H28O3 — CID 57082521
5-hydroxy-4-(3-hydroxy-4,4-dimethylocta-1,7-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 57082521) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 5-hydroxy-4-(3-hydroxy-4,4-dimethylocta-1,7-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | 5-hydroxy-4-(3-hydroxy-4,4-dimethylocta-1,7-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 57082521 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 5-hydroxy-4-(3-hydroxy-4,4-dimethylocta-1,7-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C=CCCC(C)(C)C(O)C=CC1C(O)CC2CC(=O)CC21 |
| InChI | InChI=1S/C18H28O3/c1-4-5-8-18(2,3)17(21)7-6-14-15-11-13(19)9-12(15)10-16(14)20/h4,6-7,12,14-17,20-21H,1,5,8-11H2,2-3H3 |
| InChIKey | OMSVCXXOOWAJPF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|