C15H13N2O3S- — CID 57083020
4-(naphthalene-1-carbonyl)-3,5-dihydro-2H-pyrazine-6-sulfinate (PubChem CID 57083020) has the molecular formula C15H13N2O3S- and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-(naphthalene-1-carbonyl)-3,5-dihydro-2H-pyrazine-6-sulfinate.
| Compound Name | 4-(naphthalene-1-carbonyl)-3,5-dihydro-2H-pyrazine-6-sulfinate |
|---|---|
| PubChem CID | 57083020 |
| Molecular Formula | C15H13N2O3S- |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-(naphthalene-1-carbonyl)-3,5-dihydro-2H-pyrazine-6-sulfinate |
| SMILES | O=C(c1cccc2ccccc12)N1CCN=C(S(=O)[O-])C1 |
| InChI | InChI=1S/C15H14N2O3S/c18-15(17-9-8-16-14(10-17)21(19)20)13-7-3-5-11-4-1-2-6-12(11)13/h1-7H,8-10H2,(H,19,20)/p-1 |
| InChIKey | PEWGWMLLNMJBFU-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|