About O-propyl propylsulfanylmethanethioate
O-propyl propylsulfanylmethanethioate (PubChem CID 57083148) has the molecular formula C7H14OS2
and a molecular weight of 178.32 g/mol. Its IUPAC name is O-propyl propylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-propyl propylsulfanylmethanethioate |
| PubChem CID | 57083148 |
| Molecular Formula | C7H14OS2 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | O-propyl propylsulfanylmethanethioate |
| SMILES | CCCOC(=S)SCCC |
| InChI | InChI=1S/C7H14OS2/c1-3-5-8-7(9)10-6-4-2/h3-6H2,1-2H3 |
| InChIKey | YFIPKZBRXMFZSN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-propyl propylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-propyl propylsulfanylmethanethioate?
The IUPAC name of O-propyl propylsulfanylmethanethioate (CID 57083148) is O-propyl propylsulfanylmethanethioate.
What is the SMILES notation for O-propyl propylsulfanylmethanethioate?
The canonical SMILES for O-propyl propylsulfanylmethanethioate is CCCOC(=S)SCCC.
What is the InChIKey of O-propyl propylsulfanylmethanethioate?
The InChIKey is YFIPKZBRXMFZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14OS2/c1-3-5-8-7(9)10-6-4-2/h3-6H2,1-2H3.
What are the key properties of O-propyl propylsulfanylmethanethioate?
O-propyl propylsulfanylmethanethioate has a molecular weight of 178.32 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-propyl propylsulfanylmethanethioate is sourced from PubChem (CID 57083148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).