C22H32O4 — CID 57083500
(8S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-2,10,13-trimethyl-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57083500) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (8S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-2,10,13-trimethyl-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-2,10,13-trimethyl-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57083500 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (8S,10S,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-2,10,13-trimethyl-2,4,5,6,7,8,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1C[C@]2(C)C3=CC[C@@]4(C)[C@@H](CC[C@]4(O)C(=O)CO)[C@@H]3CCC2CC1=O |
| InChI | InChI=1S/C22H32O4/c1-13-11-20(2)14(10-18(13)24)4-5-15-16(20)6-8-21(3)17(15)7-9-22(21,26)19(25)12-23/h6,13-15,17,23,26H,4-5,7-12H2,1-3H3/t13?,14?,15-,17+,20+,21+,22+/m1/s1 |
| InChIKey | CDCNOIVBWFGRAV-WPWOGDARSA-N |
| XLogP | 3.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|