C20H26N2 — CID 57084908
4-(1-benzylcycloheptyl)benzene-1,3-diamine (PubChem CID 57084908) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 4-(1-benzylcycloheptyl)benzene-1,3-diamine.
| Compound Name | 4-(1-benzylcycloheptyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 57084908 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-(1-benzylcycloheptyl)benzene-1,3-diamine |
| SMILES | Nc1ccc(C2(Cc3ccccc3)CCCCCC2)c(N)c1 |
| InChI | InChI=1S/C20H26N2/c21-17-10-11-18(19(22)14-17)20(12-6-1-2-7-13-20)15-16-8-4-3-5-9-16/h3-5,8-11,14H,1-2,6-7,12-13,15,21-22H2 |
| InChIKey | GKMCQNQDLLQECB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|