C23H31NO2 — CID 57086106
5-(1,2-diphenylethenylamino)oxynonan-2-ol (PubChem CID 57086106) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 5-(1,2-diphenylethenylamino)oxynonan-2-ol.
| Compound Name | 5-(1,2-diphenylethenylamino)oxynonan-2-ol |
|---|---|
| PubChem CID | 57086106 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 5-(1,2-diphenylethenylamino)oxynonan-2-ol |
| SMILES | CCCCC(CCC(C)O)ONC(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO2/c1-3-4-15-22(17-16-19(2)25)26-24-23(21-13-9-6-10-14-21)18-20-11-7-5-8-12-20/h5-14,18-19,22,24-25H,3-4,15-17H2,1-2H3 |
| InChIKey | AHQKPCXMBNVERM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|