C22H29NO4 — CID 57086846
(1R,9R,10S)-4-hydroxy-10-methoxy-17-(oxolan-2-ylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one (PubChem CID 57086846) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (1R,9R,10S)-4-hydroxy-10-methoxy-17-(oxolan-2-ylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one.
| Compound Name | (1R,9R,10S)-4-hydroxy-10-methoxy-17-(oxolan-2-ylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
|---|---|
| PubChem CID | 57086846 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (1R,9R,10S)-4-hydroxy-10-methoxy-17-(oxolan-2-ylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one |
| SMILES | CO[C@@]12CCC(=O)C[C@@]13CCN(CC1CCCO1)[C@@H]2Cc1ccc(O)cc13 |
| InChI | InChI=1S/C22H29NO4/c1-26-22-7-6-17(25)13-21(22)8-9-23(14-18-3-2-10-27-18)20(22)11-15-4-5-16(24)12-19(15)21/h4-5,12,18,20,24H,2-3,6-11,13-14H2,1H3/t18?,20-,21-,22-/m1/s1 |
| InChIKey | CVXDALJQUBSOBV-BADLGMOZSA-N |
| XLogP | 2.58 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |