C8H7N3O2S — CID 57087612
4-methyl-3-thiophen-2-yl-1H-1,2,4-triazine-5,6-dione (PubChem CID 57087612) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 4-methyl-3-thiophen-2-yl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 4-methyl-3-thiophen-2-yl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 57087612 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 4-methyl-3-thiophen-2-yl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1c(-c2cccs2)n[nH]c(=O)c1=O |
| InChI | InChI=1S/C8H7N3O2S/c1-11-6(5-3-2-4-14-5)9-10-7(12)8(11)13/h2-4H,1H3,(H,10,12) |
| InChIKey | IHYUVEQVVSQWAB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|