C6H9IO — CID 57088024
trans-(1S,3S)-3-iodocyclopentane-1-carbaldehyde (PubChem CID 57088024) has the molecular formula C6H9IO and a molecular weight of 224.04 g/mol. Its IUPAC name is trans-(1S,3S)-3-iodocyclopentane-1-carbaldehyde.
| Compound Name | trans-(1S,3S)-3-iodocyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 57088024 |
| Molecular Formula | C6H9IO |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | trans-(1S,3S)-3-iodocyclopentane-1-carbaldehyde |
| SMILES | O=C[C@H]1CC[C@H](I)C1 |
| InChI | InChI=1S/C6H9IO/c7-6-2-1-5(3-6)4-8/h4-6H,1-3H2/t5-,6-/m0/s1 |
| InChIKey | UBJAWOVUTXTWIZ-WDSKDSINSA-N |
| XLogP | 1.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|