About 2-prop-2-ynoxy-1H-indole
2-prop-2-ynoxy-1H-indole (PubChem CID 57088946) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-prop-2-ynoxy-1H-indole.
Molecular Properties
| Compound Name | 2-prop-2-ynoxy-1H-indole |
| PubChem CID | 57088946 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 2-prop-2-ynoxy-1H-indole |
| SMILES | C#CCOc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H9NO/c1-2-7-13-11-8-9-5-3-4-6-10(9)12-11/h1,3-6,8,12H,7H2 |
| InChIKey | IHGOQLQFKIHNLA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-ynoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-ynoxy-1H-indole?
The IUPAC name of 2-prop-2-ynoxy-1H-indole (CID 57088946) is 2-prop-2-ynoxy-1H-indole.
What is the SMILES notation for 2-prop-2-ynoxy-1H-indole?
The canonical SMILES for 2-prop-2-ynoxy-1H-indole is C#CCOc1cc2ccccc2[nH]1.
What is the InChIKey of 2-prop-2-ynoxy-1H-indole?
The InChIKey is IHGOQLQFKIHNLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c1-2-7-13-11-8-9-5-3-4-6-10(9)12-11/h1,3-6,8,12H,7H2.
What are the key properties of 2-prop-2-ynoxy-1H-indole?
2-prop-2-ynoxy-1H-indole has a molecular weight of 171.20 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-ynoxy-1H-indole is sourced from PubChem (CID 57088946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).