C11H8Cl3NO3 — CID 54455783
1H-indol-2-yl 2,2,2-trichloroethyl carbonate (PubChem CID 54455783) has the molecular formula C11H8Cl3NO3 and a molecular weight of 308.55 g/mol. Its IUPAC name is 1H-indol-2-yl 2,2,2-trichloroethyl carbonate.
| Compound Name | 1H-indol-2-yl 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 54455783 |
| Molecular Formula | C11H8Cl3NO3 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 1H-indol-2-yl 2,2,2-trichloroethyl carbonate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)Oc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H8Cl3NO3/c12-11(13,14)6-17-10(16)18-9-5-7-3-1-2-4-8(7)15-9/h1-5,15H,6H2 |
| InChIKey | WYCACLZZHSALTN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|