C18H17N3 — CID 57089316
1-phenyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)indole (PubChem CID 57089316) has the molecular formula C18H17N3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-phenyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)indole.
| Compound Name | 1-phenyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)indole |
|---|---|
| PubChem CID | 57089316 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-phenyl-2-(1,4,5,6-tetrahydropyrimidin-2-yl)indole |
| SMILES | c1ccc(-n2c(C3=NCCCN3)cc3ccccc32)cc1 |
| InChI | InChI=1S/C18H17N3/c1-2-8-15(9-3-1)21-16-10-5-4-7-14(16)13-17(21)18-19-11-6-12-20-18/h1-5,7-10,13H,6,11-12H2,(H,19,20) |
| InChIKey | UTRTYPACFKAISU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |