C20H17N3O6 — CID 57089621
(19S)-19-ethyl-7,19-dihydroxy-12-(hydroxyamino)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione (PubChem CID 57089621) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is (19S)-19-ethyl-7,19-dihydroxy-12-(hydroxyamino)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-19-ethyl-7,19-dihydroxy-12-(hydroxyamino)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 57089621 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (19S)-19-ethyl-7,19-dihydroxy-12-(hydroxyamino)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)C(NO)c2cc3cc(O)ccc3nc2-1 |
| InChI | InChI=1S/C20H17N3O6/c1-2-20(27)13-7-15-16-11(6-9-5-10(24)3-4-14(9)21-16)17(22-28)23(15)18(25)12(13)8-29-19(20)26/h3-7,17,22,24,27-28H,2,8H2,1H3/t17?,20-/m0/s1 |
| InChIKey | MKQRSRFDFDZESX-OZBJMMHXSA-N |
| XLogP | 1.26 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|