C24H25N3O5 — CID 24877143
19-ethyl-19-hydroxy-12-methyl-14,18-dioxo-7-(trimethylazaniumyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-8-olate (PubChem CID 24877143) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 19-ethyl-19-hydroxy-12-methyl-14,18-dioxo-7-(trimethylazaniumyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-8-olate.
| Compound Name | 19-ethyl-19-hydroxy-12-methyl-14,18-dioxo-7-(trimethylazaniumyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-8-olate |
|---|---|
| PubChem CID | 24877143 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 19-ethyl-19-hydroxy-12-methyl-14,18-dioxo-7-(trimethylazaniumyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-8-olate |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)C(C)c2cc3c([O-])c([N+](C)(C)C)ccc3nc2-1 |
| InChI | InChI=1S/C24H25N3O5/c1-6-24(31)16-10-18-20-13(12(2)26(18)22(29)15(16)11-32-23(24)30)9-14-17(25-20)7-8-19(21(14)28)27(3,4)5/h7-10,12,31H,6,11H2,1-5H3 |
| InChIKey | QMWNMFFJMVXPOO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 104.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|