C10H12N4O6 — CID 57092977
3-acetamido-4-azido-6-methoxycarbonyl-3,4-dihydro-2H-pyran-2-carboxylic acid (PubChem CID 57092977) has the molecular formula C10H12N4O6 and a molecular weight of 284.23 g/mol. Its IUPAC name is 3-acetamido-4-azido-6-methoxycarbonyl-3,4-dihydro-2H-pyran-2-carboxylic acid.
| Compound Name | 3-acetamido-4-azido-6-methoxycarbonyl-3,4-dihydro-2H-pyran-2-carboxylic acid |
|---|---|
| PubChem CID | 57092977 |
| Molecular Formula | C10H12N4O6 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-acetamido-4-azido-6-methoxycarbonyl-3,4-dihydro-2H-pyran-2-carboxylic acid |
| SMILES | COC(=O)C1=CC(N=[N+]=[N-])C(NC(C)=O)C(C(=O)O)O1 |
| InChI | InChI=1S/C10H12N4O6/c1-4(15)12-7-5(13-14-11)3-6(10(18)19-2)20-8(7)9(16)17/h3,5,7-8H,1-2H3,(H,12,15)(H,16,17) |
| InChIKey | HGPNAFCFEKYHRL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 150.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|