C19H30O3 — CID 57094482
5-hydroxy-4-(3-hydroxy-4,4-dimethylnona-1,8-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 57094482) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 5-hydroxy-4-(3-hydroxy-4,4-dimethylnona-1,8-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | 5-hydroxy-4-(3-hydroxy-4,4-dimethylnona-1,8-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 57094482 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 5-hydroxy-4-(3-hydroxy-4,4-dimethylnona-1,8-dienyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C=CCCCC(C)(C)C(O)C=CC1C(O)CC2CC(=O)CC21 |
| InChI | InChI=1S/C19H30O3/c1-4-5-6-9-19(2,3)18(22)8-7-15-16-12-14(20)10-13(16)11-17(15)21/h4,7-8,13,15-18,21-22H,1,5-6,9-12H2,2-3H3 |
| InChIKey | HLSOZZCDXFOKSC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|