C16H30O5 — CID 57094681
3-[3-(4-ethyloctanoyloxy)propoxy]propanoic acid (PubChem CID 57094681) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is 3-[3-(4-ethyloctanoyloxy)propoxy]propanoic acid.
| Compound Name | 3-[3-(4-ethyloctanoyloxy)propoxy]propanoic acid |
|---|---|
| PubChem CID | 57094681 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 3-[3-(4-ethyloctanoyloxy)propoxy]propanoic acid |
| SMILES | CCCCC(CC)CCC(=O)OCCCOCCC(=O)O |
| InChI | InChI=1S/C16H30O5/c1-3-5-7-14(4-2)8-9-16(19)21-12-6-11-20-13-10-15(17)18/h14H,3-13H2,1-2H3,(H,17,18) |
| InChIKey | ZLDJLMPNIZPJJA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|