C18H21N3O5S2 — CID 57096078
tert-butyl (6S,7R)-3-methyl-7-[(2-nitrophenyl)sulfanylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 57096078) has the molecular formula C18H21N3O5S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is tert-butyl (6S,7R)-3-methyl-7-[(2-nitrophenyl)sulfanylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6S,7R)-3-methyl-7-[(2-nitrophenyl)sulfanylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 57096078 |
| Molecular Formula | C18H21N3O5S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | tert-butyl (6S,7R)-3-methyl-7-[(2-nitrophenyl)sulfanylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)N2C(=O)[C@@H](NSc3ccccc3[N+](=O)[O-])[C@@H]2SC1 |
| InChI | InChI=1S/C18H21N3O5S2/c1-10-9-27-16-13(19-28-12-8-6-5-7-11(12)21(24)25)15(22)20(16)14(10)17(23)26-18(2,3)4/h5-8,13,16,19H,9H2,1-4H3/t13-,16+/m1/s1 |
| InChIKey | VQWLMCIYANMIPU-CJNGLKHVSA-N |
| XLogP | 3.09 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|