C18H21N3O6S2 — CID 154417434
tert-butyl (6R,7R)-3-methyl-7-[(4-nitrophenyl)sulfinylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154417434) has the molecular formula C18H21N3O6S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is tert-butyl (6R,7R)-3-methyl-7-[(4-nitrophenyl)sulfinylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R,7R)-3-methyl-7-[(4-nitrophenyl)sulfinylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154417434 |
| Molecular Formula | C18H21N3O6S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | tert-butyl (6R,7R)-3-methyl-7-[(4-nitrophenyl)sulfinylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)N2C(=O)[C@@H](NS(=O)c3ccc([N+](=O)[O-])cc3)[C@H]2SC1 |
| InChI | InChI=1S/C18H21N3O6S2/c1-10-9-28-16-13(15(22)20(16)14(10)17(23)27-18(2,3)4)19-29(26)12-7-5-11(6-8-12)21(24)25/h5-8,13,16,19H,9H2,1-4H3/t13-,16-,29?/m1/s1 |
| InChIKey | WBUIMCGAQZWEQN-CCCCKEMESA-N |
| XLogP | 2.11 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|