C21H23N5O7S — CID 70509131
tert-butyl (6R)-3-(acetyloxymethyl)-7-[(6-nitro-1H-benzimidazol-2-yl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70509131) has the molecular formula C21H23N5O7S and a molecular weight of 489.51 g/mol. Its IUPAC name is tert-butyl (6R)-3-(acetyloxymethyl)-7-[(6-nitro-1H-benzimidazol-2-yl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R)-3-(acetyloxymethyl)-7-[(6-nitro-1H-benzimidazol-2-yl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70509131 |
| Molecular Formula | C21H23N5O7S |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | tert-butyl (6R)-3-(acetyloxymethyl)-7-[(6-nitro-1H-benzimidazol-2-yl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(C)(C)C)N2C(=O)C(Nc3nc4ccc([N+](=O)[O-])cc4[nH]3)[C@H]2SC1 |
| InChI | InChI=1S/C21H23N5O7S/c1-10(27)32-8-11-9-34-18-15(17(28)25(18)16(11)19(29)33-21(2,3)4)24-20-22-13-6-5-12(26(30)31)7-14(13)23-20/h5-7,15,18H,8-9H2,1-4H3,(H2,22,23,24)/t15?,18-/m1/s1 |
| InChIKey | FZGONIFAEWYWQG-KPMSDPLLSA-N |
| XLogP | 2.33 |
| TPSA | 156.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|