C29H38FN3O4 — CID 57096177
[(1S,2S)-2-[2-[4-(1H-benzimidazol-2-yl)butyl-hydroxyamino]ethyl]-6-fluoro-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-yl] 2-methoxyacetate (PubChem CID 57096177) has the molecular formula C29H38FN3O4 and a molecular weight of 511.64 g/mol. Its IUPAC name is [(1S,2S)-2-[2-[4-(1H-benzimidazol-2-yl)butyl-hydroxyamino]ethyl]-6-fluoro-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-yl] 2-methoxyacetate.
| Compound Name | [(1S,2S)-2-[2-[4-(1H-benzimidazol-2-yl)butyl-hydroxyamino]ethyl]-6-fluoro-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 57096177 |
| Molecular Formula | C29H38FN3O4 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | [(1S,2S)-2-[2-[4-(1H-benzimidazol-2-yl)butyl-hydroxyamino]ethyl]-6-fluoro-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-yl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@]1(CCN(O)CCCCc2nc3ccccc3[nH]2)CCc2cc(F)ccc2[C@@H]1C(C)C |
| InChI | InChI=1S/C29H38FN3O4/c1-20(2)28-23-12-11-22(30)18-21(23)13-14-29(28,37-27(34)19-36-3)15-17-33(35)16-7-6-10-26-31-24-8-4-5-9-25(24)32-26/h4-5,8-9,11-12,18,20,28,35H,6-7,10,13-17,19H2,1-3H3,(H,31,32)/t28-,29-/m0/s1 |
| InChIKey | LHMCRPUDXIHXLN-VMPREFPWSA-N |
| XLogP | 5.42 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|