C29H36F3N3O3 — CID 68750532
[(1R,2R)-2-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-4,4,6-trifluoro-1-propan-2-yl-1,3-dihydronaphthalen-2-yl] 2-methoxyacetate (PubChem CID 68750532) has the molecular formula C29H36F3N3O3 and a molecular weight of 531.62 g/mol. Its IUPAC name is [(1R,2R)-2-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-4,4,6-trifluoro-1-propan-2-yl-1,3-dihydronaphthalen-2-yl] 2-methoxyacetate.
| Compound Name | [(1R,2R)-2-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-4,4,6-trifluoro-1-propan-2-yl-1,3-dihydronaphthalen-2-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 68750532 |
| Molecular Formula | C29H36F3N3O3 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | [(1R,2R)-2-[2-[3-(1H-benzimidazol-2-yl)propyl-methylamino]ethyl]-4,4,6-trifluoro-1-propan-2-yl-1,3-dihydronaphthalen-2-yl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@]1(CCN(C)CCCc2nc3ccccc3[nH]2)CC(F)(F)c2cc(F)ccc2[C@H]1C(C)C |
| InChI | InChI=1S/C29H36F3N3O3/c1-19(2)27-21-12-11-20(30)16-22(21)29(31,32)18-28(27,38-26(36)17-37-4)13-15-35(3)14-7-10-25-33-23-8-5-6-9-24(23)34-25/h5-6,8-9,11-12,16,19,27H,7,10,13-15,17-18H2,1-4H3,(H,33,34)/t27-,28-/m1/s1 |
| InChIKey | WAUYMJSTDOOLKZ-VSGBNLITSA-N |
| XLogP | 5.82 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |