C17H22N6O7 — CID 57097158
N-[2-[(2S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxy-2-oxoethoxy]cyclopentanecarboxamide (PubChem CID 57097158) has the molecular formula C17H22N6O7 and a molecular weight of 422.40 g/mol. Its IUPAC name is N-[2-[(2S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxy-2-oxoethoxy]cyclopentanecarboxamide.
| Compound Name | N-[2-[(2S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxy-2-oxoethoxy]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 57097158 |
| Molecular Formula | C17H22N6O7 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[2-[(2S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxy-2-oxoethoxy]cyclopentanecarboxamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)C(O)ONC(=O)C2CCCC2)C(O)C1O |
| InChI | InChI=1S/C17H22N6O7/c18-13-8-14(20-5-19-13)23(6-21-8)16-10(25)9(24)12(29-16)11(26)17(28)30-22-15(27)7-3-1-2-4-7/h5-7,9-10,12,16-17,24-25,28H,1-4H2,(H,22,27)(H2,18,19,20)/t9?,10?,12-,16+,17?/m0/s1 |
| InChIKey | QPSIDFVWQPOBAE-HQRVRUNESA-N |
| XLogP | -1.85 |
| TPSA | 194.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|