About 4-(3-methyloxiran-2-yl)heptane-1,7-diamine
4-(3-methyloxiran-2-yl)heptane-1,7-diamine (PubChem CID 57097644) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-(3-methyloxiran-2-yl)heptane-1,7-diamine.
Molecular Properties
| Compound Name | 4-(3-methyloxiran-2-yl)heptane-1,7-diamine |
| PubChem CID | 57097644 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-(3-methyloxiran-2-yl)heptane-1,7-diamine |
| SMILES | CC1OC1C(CCCN)CCCN |
| InChI | InChI=1S/C10H22N2O/c1-8-10(13-8)9(4-2-6-11)5-3-7-12/h8-10H,2-7,11-12H2,1H3 |
| InChIKey | ASDMROPNZRTKBE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methyloxiran-2-yl)heptane-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyloxiran-2-yl)heptane-1,7-diamine?
The IUPAC name of 4-(3-methyloxiran-2-yl)heptane-1,7-diamine (CID 57097644) is 4-(3-methyloxiran-2-yl)heptane-1,7-diamine.
What is the SMILES notation for 4-(3-methyloxiran-2-yl)heptane-1,7-diamine?
The canonical SMILES for 4-(3-methyloxiran-2-yl)heptane-1,7-diamine is CC1OC1C(CCCN)CCCN.
What is the InChIKey of 4-(3-methyloxiran-2-yl)heptane-1,7-diamine?
The InChIKey is ASDMROPNZRTKBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-8-10(13-8)9(4-2-6-11)5-3-7-12/h8-10H,2-7,11-12H2,1H3.
What are the key properties of 4-(3-methyloxiran-2-yl)heptane-1,7-diamine?
4-(3-methyloxiran-2-yl)heptane-1,7-diamine has a molecular weight of 186.30 g/mol, XLogP of 0.87, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyloxiran-2-yl)heptane-1,7-diamine is sourced from PubChem (CID 57097644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).