C28H36N4O3 — CID 57100835
N-[(2S,3S,5S)-5-carbamoyl-3-hydroxy-1-phenyl-6-propylnonan-2-yl]quinoxaline-2-carboxamide (PubChem CID 57100835) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[(2S,3S,5S)-5-carbamoyl-3-hydroxy-1-phenyl-6-propylnonan-2-yl]quinoxaline-2-carboxamide.
| Compound Name | N-[(2S,3S,5S)-5-carbamoyl-3-hydroxy-1-phenyl-6-propylnonan-2-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 57100835 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | N-[(2S,3S,5S)-5-carbamoyl-3-hydroxy-1-phenyl-6-propylnonan-2-yl]quinoxaline-2-carboxamide |
| SMILES | CCCC(CCC)[C@H](C[C@H](O)[C@H](Cc1ccccc1)NC(=O)c1cnc2ccccc2n1)C(N)=O |
| InChI | InChI=1S/C28H36N4O3/c1-3-10-20(11-4-2)21(27(29)34)17-26(33)24(16-19-12-6-5-7-13-19)32-28(35)25-18-30-22-14-8-9-15-23(22)31-25/h5-9,12-15,18,20-21,24,26,33H,3-4,10-11,16-17H2,1-2H3,(H2,29,34)(H,32,35)/t21-,24-,26-/m0/s1 |
| InChIKey | QSYCSTTZAIIFQZ-CVJWPJSTSA-N |
| XLogP | 4.04 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |