C28H34N4O5 — CID 56980513
N-[(2S,3S,5S)-3-hydroxy-6-(hydroxyamino)-5-(1-hydroxycycloheptyl)-6-oxo-1-phenylhexan-2-yl]quinoxaline-2-carboxamide (PubChem CID 56980513) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is N-[(2S,3S,5S)-3-hydroxy-6-(hydroxyamino)-5-(1-hydroxycycloheptyl)-6-oxo-1-phenylhexan-2-yl]quinoxaline-2-carboxamide.
| Compound Name | N-[(2S,3S,5S)-3-hydroxy-6-(hydroxyamino)-5-(1-hydroxycycloheptyl)-6-oxo-1-phenylhexan-2-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 56980513 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | N-[(2S,3S,5S)-3-hydroxy-6-(hydroxyamino)-5-(1-hydroxycycloheptyl)-6-oxo-1-phenylhexan-2-yl]quinoxaline-2-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@@H](O)CC(C(=O)NO)C1(O)CCCCCC1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C28H34N4O5/c33-25(17-20(26(34)32-37)28(36)14-8-1-2-9-15-28)23(16-19-10-4-3-5-11-19)31-27(35)24-18-29-21-12-6-7-13-22(21)30-24/h3-7,10-13,18,20,23,25,33,36-37H,1-2,8-9,14-17H2,(H,31,35)(H,32,34)/t20?,23-,25-/m0/s1 |
| InChIKey | XMYMHBLLRAGEJY-WAXYSGSMSA-N |
| XLogP | 2.93 |
| TPSA | 144.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|