C29H33F3N4O7 — CID 54510938
N-[3-hydroxy-6-(hydroxyamino)-5-(4-hydroxy-2,6-dimethyloxan-4-yl)-6-oxo-1-[3-(trifluoromethoxy)phenyl]hexan-2-yl]quinoxaline-2-carboxamide (PubChem CID 54510938) has the molecular formula C29H33F3N4O7 and a molecular weight of 606.60 g/mol. Its IUPAC name is N-[3-hydroxy-6-(hydroxyamino)-5-(4-hydroxy-2,6-dimethyloxan-4-yl)-6-oxo-1-[3-(trifluoromethoxy)phenyl]hexan-2-yl]quinoxaline-2-carboxamide.
| Compound Name | N-[3-hydroxy-6-(hydroxyamino)-5-(4-hydroxy-2,6-dimethyloxan-4-yl)-6-oxo-1-[3-(trifluoromethoxy)phenyl]hexan-2-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 54510938 |
| Molecular Formula | C29H33F3N4O7 |
| Molecular Weight | 606.60 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | N-[3-hydroxy-6-(hydroxyamino)-5-(4-hydroxy-2,6-dimethyloxan-4-yl)-6-oxo-1-[3-(trifluoromethoxy)phenyl]hexan-2-yl]quinoxaline-2-carboxamide |
| SMILES | CC1CC(O)(C(CC(O)C(Cc2cccc(OC(F)(F)F)c2)NC(=O)c2cnc3ccccc3n2)C(=O)NO)CC(C)O1 |
| InChI | InChI=1S/C29H33F3N4O7/c1-16-13-28(40,14-17(2)42-16)20(26(38)36-41)12-25(37)23(11-18-6-5-7-19(10-18)43-29(30,31)32)35-27(39)24-15-33-21-8-3-4-9-22(21)34-24/h3-10,15-17,20,23,25,37,40-41H,11-14H2,1-2H3,(H,35,39)(H,36,38) |
| InChIKey | YJBILFQLYABGSB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 163.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|