C52H60F2N8O10S — CID 87964340
bis[(2S,3R,5R)-5-carbamoyl-1-(3-fluorophenyl)-8-hydroxy-8-methyl-2-(quinoxaline-2-carbonylamino)nonan-3-yl] sulfate (PubChem CID 87964340) has the molecular formula C52H60F2N8O10S and a molecular weight of 1027.16 g/mol. Its IUPAC name is bis[(2S,3R,5R)-5-carbamoyl-1-(3-fluorophenyl)-8-hydroxy-8-methyl-2-(quinoxaline-2-carbonylamino)nonan-3-yl] sulfate.
| Compound Name | bis[(2S,3R,5R)-5-carbamoyl-1-(3-fluorophenyl)-8-hydroxy-8-methyl-2-(quinoxaline-2-carbonylamino)nonan-3-yl] sulfate |
|---|---|
| PubChem CID | 87964340 |
| Molecular Formula | C52H60F2N8O10S |
| Molecular Weight | 1027.16 g/mol |
| Exact Mass | 1026.41 |
| IUPAC Name | bis[(2S,3R,5R)-5-carbamoyl-1-(3-fluorophenyl)-8-hydroxy-8-methyl-2-(quinoxaline-2-carbonylamino)nonan-3-yl] sulfate |
| SMILES | CC(C)(O)CC[C@H](C[C@@H](OS(=O)(=O)O[C@H](C[C@@H](CCC(C)(C)O)C(N)=O)[C@H](Cc1cccc(F)c1)NC(=O)c1cnc2ccccc2n1)[C@H](Cc1cccc(F)c1)NC(=O)c1cnc2ccccc2n1)C(N)=O |
| InChI | InChI=1S/C52H60F2N8O10S/c1-51(2,67)21-19-33(47(55)63)27-45(41(25-31-11-9-13-35(53)23-31)61-49(65)43-29-57-37-15-5-7-17-39(37)59-43)71-73(69,70)72-46(28-34(48(56)64)20-22-52(3,4)68)42(26-32-12-10-14-36(54)24-32)62-50(66)44-30-58-38-16-6-8-18-40(38)60-44/h5-18,23-24,29-30,33-34,41-42,45-46,67-68H,19-22,25-28H2,1-4H3,(H2,55,63)(H2,56,64)(H,61,65)(H,62,66)/t33-,34-,41+,42+,45-,46-/m1/s1 |
| InChIKey | JHLZACMZNNWRAO-XPWOXUSKSA-N |
| XLogP | 5.33 |
| TPSA | 289.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 73 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.16 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |