C56H62F2N8O10 — CID 173204205
bis[(2S,3R,5R)-5-carbamoyl-1-(3-fluorophenyl)-8-hydroxy-8-methyl-2-(quinoxaline-2-carbonylamino)nonan-3-yl] but-2-enedioate (PubChem CID 173204205) has the molecular formula C56H62F2N8O10 and a molecular weight of 1045.15 g/mol. Its IUPAC name is bis[(2S,3R,5R)-5-carbamoyl-1-(3-fluorophenyl)-8-hydroxy-8-methyl-2-(quinoxaline-2-carbonylamino)nonan-3-yl] but-2-enedioate.
| Compound Name | bis[(2S,3R,5R)-5-carbamoyl-1-(3-fluorophenyl)-8-hydroxy-8-methyl-2-(quinoxaline-2-carbonylamino)nonan-3-yl] but-2-enedioate |
|---|---|
| PubChem CID | 173204205 |
| Molecular Formula | C56H62F2N8O10 |
| Molecular Weight | 1045.15 g/mol |
| Exact Mass | 1044.46 |
| IUPAC Name | bis[(2S,3R,5R)-5-carbamoyl-1-(3-fluorophenyl)-8-hydroxy-8-methyl-2-(quinoxaline-2-carbonylamino)nonan-3-yl] but-2-enedioate |
| SMILES | CC(C)(O)CC[C@H](C[C@@H](OC(=O)C=CC(=O)O[C@H](C[C@@H](CCC(C)(C)O)C(N)=O)[C@H](Cc1cccc(F)c1)NC(=O)c1cnc2ccccc2n1)[C@H](Cc1cccc(F)c1)NC(=O)c1cnc2ccccc2n1)C(N)=O |
| InChI | InChI=1S/C56H62F2N8O10/c1-55(2,73)23-21-35(51(59)69)29-47(43(27-33-11-9-13-37(57)25-33)65-53(71)45-31-61-39-15-5-7-17-41(39)63-45)75-49(67)19-20-50(68)76-48(30-36(52(60)70)22-24-56(3,4)74)44(28-34-12-10-14-38(58)26-34)66-54(72)46-32-62-40-16-6-8-18-42(40)64-46/h5-20,25-26,31-32,35-36,43-44,47-48,73-74H,21-24,27-30H2,1-4H3,(H2,59,69)(H2,60,70)(H,65,71)(H,66,72)/t35-,36-,43+,44+,47-,48-/m1/s1 |
| InChIKey | GCELDVWDTMLVHW-JLQLJWEGSA-N |
| XLogP | 5.70 |
| TPSA | 289.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 76 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.15 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|