C8H5Cl3N2O2S — CID 57103382
chloro-(1,3-dichloroquinoxalin-2-ylidene)-hydroxy-oxo-λ6-sulfane (PubChem CID 57103382) has the molecular formula C8H5Cl3N2O2S and a molecular weight of 299.57 g/mol. Its IUPAC name is chloro-(1,3-dichloroquinoxalin-2-ylidene)-hydroxy-oxo-λ6-sulfane.
| Compound Name | chloro-(1,3-dichloroquinoxalin-2-ylidene)-hydroxy-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 57103382 |
| Molecular Formula | C8H5Cl3N2O2S |
| Molecular Weight | 299.57 g/mol |
| Exact Mass | 297.91 |
| IUPAC Name | chloro-(1,3-dichloroquinoxalin-2-ylidene)-hydroxy-oxo-λ6-sulfane |
| SMILES | O=S(O)(Cl)=c1c(Cl)nc2ccccc2n1Cl |
| InChI | InChI=1S/C8H5Cl3N2O2S/c9-7-8(16(11,14)15)13(10)6-4-2-1-3-5(6)12-7/h1-4H,(H,14,15) |
| InChIKey | UUVKRNLODMOYBJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|