C19H17F2N3OS — CID 57103666
2-(4-fluorophenyl)-4-(4-fluorophenyl)sulfanyl-3-methyl-1-(2H-triazol-4-yl)but-3-en-2-ol (PubChem CID 57103666) has the molecular formula C19H17F2N3OS and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(4-fluorophenyl)sulfanyl-3-methyl-1-(2H-triazol-4-yl)but-3-en-2-ol.
| Compound Name | 2-(4-fluorophenyl)-4-(4-fluorophenyl)sulfanyl-3-methyl-1-(2H-triazol-4-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 57103666 |
| Molecular Formula | C19H17F2N3OS |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(4-fluorophenyl)sulfanyl-3-methyl-1-(2H-triazol-4-yl)but-3-en-2-ol |
| SMILES | CC(=CSc1ccc(F)cc1)C(O)(Cc1cn[nH]n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17F2N3OS/c1-13(12-26-18-8-6-16(21)7-9-18)19(25,10-17-11-22-24-23-17)14-2-4-15(20)5-3-14/h2-9,11-12,25H,10H2,1H3,(H,22,23,24) |
| InChIKey | XMZWETNUXNTOJW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |