C10H14O6 — CID 57103772
(5S)-5-[(4S)-2-ethyl-2-methyl-1,3-dioxolan-4-yl]-4-hydroxyoxolane-2,3-dione (PubChem CID 57103772) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is (5S)-5-[(4S)-2-ethyl-2-methyl-1,3-dioxolan-4-yl]-4-hydroxyoxolane-2,3-dione.
| Compound Name | (5S)-5-[(4S)-2-ethyl-2-methyl-1,3-dioxolan-4-yl]-4-hydroxyoxolane-2,3-dione |
|---|---|
| PubChem CID | 57103772 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (5S)-5-[(4S)-2-ethyl-2-methyl-1,3-dioxolan-4-yl]-4-hydroxyoxolane-2,3-dione |
| SMILES | CCC1(C)OC[C@@H]([C@H]2OC(=O)C(=O)C2O)O1 |
| InChI | InChI=1S/C10H14O6/c1-3-10(2)14-4-5(16-10)8-6(11)7(12)9(13)15-8/h5-6,8,11H,3-4H2,1-2H3/t5-,6?,8+,10?/m0/s1 |
| InChIKey | DFGJGLIVXUZCAW-OWORPVFJSA-N |
| XLogP | -0.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|