C10H18O5 — CID 123450262
5-(2-ethyl-2-methyl-1,3-dioxolan-4-yl)oxolane-2,3-diol (PubChem CID 123450262) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 5-(2-ethyl-2-methyl-1,3-dioxolan-4-yl)oxolane-2,3-diol.
| Compound Name | 5-(2-ethyl-2-methyl-1,3-dioxolan-4-yl)oxolane-2,3-diol |
|---|---|
| PubChem CID | 123450262 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-(2-ethyl-2-methyl-1,3-dioxolan-4-yl)oxolane-2,3-diol |
| SMILES | CCC1(C)OCC(C2CC(O)C(O)O2)O1 |
| InChI | InChI=1S/C10H18O5/c1-3-10(2)13-5-8(15-10)7-4-6(11)9(12)14-7/h6-9,11-12H,3-5H2,1-2H3 |
| InChIKey | LCJMKKOLVYXRBN-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |